C23H26BrClN2O6 — CID 108932313
[4-[3-[4-(4-bromo-2-chlorophenoxy)butanoylamino]propylcarbamoyl]phenyl] ethyl carbonate (PubChem CID 108932313) has the molecular formula C23H26BrClN2O6 and a molecular weight of 541.83 g/mol. Its IUPAC name is [4-[3-[4-(4-bromo-2-chlorophenoxy)butanoylamino]propylcarbamoyl]phenyl] ethyl carbonate.
| Compound Name | [4-[3-[4-(4-bromo-2-chlorophenoxy)butanoylamino]propylcarbamoyl]phenyl] ethyl carbonate |
|---|---|
| PubChem CID | 108932313 |
| Molecular Formula | C23H26BrClN2O6 |
| Molecular Weight | 541.83 g/mol |
| Exact Mass | 540.07 |
| IUPAC Name | [4-[3-[4-(4-bromo-2-chlorophenoxy)butanoylamino]propylcarbamoyl]phenyl] ethyl carbonate |
| SMILES | CCOC(=O)Oc1ccc(C(=O)NCCCNC(=O)CCCOc2ccc(Br)cc2Cl)cc1 |
| InChI | InChI=1S/C23H26BrClN2O6/c1-2-31-23(30)33-18-9-6-16(7-10-18)22(29)27-13-4-12-26-21(28)5-3-14-32-20-11-8-17(24)15-19(20)25/h6-11,15H,2-5,12-14H2,1H3,(H,26,28)(H,27,29) |
| InChIKey | QKPOVKUUZQPDTF-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.83 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|