C23H22BrN3O7 — CID 108932343
[4-[3-[[2-(5-bromo-1,3-dioxoisoindol-2-yl)acetyl]amino]propylcarbamoyl]phenyl] ethyl carbonate (PubChem CID 108932343) has the molecular formula C23H22BrN3O7 and a molecular weight of 532.35 g/mol. Its IUPAC name is [4-[3-[[2-(5-bromo-1,3-dioxoisoindol-2-yl)acetyl]amino]propylcarbamoyl]phenyl] ethyl carbonate.
| Compound Name | [4-[3-[[2-(5-bromo-1,3-dioxoisoindol-2-yl)acetyl]amino]propylcarbamoyl]phenyl] ethyl carbonate |
|---|---|
| PubChem CID | 108932343 |
| Molecular Formula | C23H22BrN3O7 |
| Molecular Weight | 532.35 g/mol |
| Exact Mass | 531.06 |
| IUPAC Name | [4-[3-[[2-(5-bromo-1,3-dioxoisoindol-2-yl)acetyl]amino]propylcarbamoyl]phenyl] ethyl carbonate |
| SMILES | CCOC(=O)Oc1ccc(C(=O)NCCCNC(=O)CN2C(=O)c3ccc(Br)cc3C2=O)cc1 |
| InChI | InChI=1S/C23H22BrN3O7/c1-2-33-23(32)34-16-7-4-14(5-8-16)20(29)26-11-3-10-25-19(28)13-27-21(30)17-9-6-15(24)12-18(17)22(27)31/h4-9,12H,2-3,10-11,13H2,1H3,(H,25,28)(H,26,29) |
| InChIKey | ZDIHRQSTYCMDAX-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.35 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|