C16H18BrN3O5 — CID 108542690
N-[2-[[2-(5-bromo-1,3-dioxoisoindol-2-yl)acetyl]amino]ethyl]-3-methoxypropanamide (PubChem CID 108542690) has the molecular formula C16H18BrN3O5 and a molecular weight of 412.24 g/mol. Its IUPAC name is N-[2-[[2-(5-bromo-1,3-dioxoisoindol-2-yl)acetyl]amino]ethyl]-3-methoxypropanamide.
| Compound Name | N-[2-[[2-(5-bromo-1,3-dioxoisoindol-2-yl)acetyl]amino]ethyl]-3-methoxypropanamide |
|---|---|
| PubChem CID | 108542690 |
| Molecular Formula | C16H18BrN3O5 |
| Molecular Weight | 412.24 g/mol |
| Exact Mass | 411.04 |
| IUPAC Name | N-[2-[[2-(5-bromo-1,3-dioxoisoindol-2-yl)acetyl]amino]ethyl]-3-methoxypropanamide |
| SMILES | COCCC(=O)NCCNC(=O)CN1C(=O)c2ccc(Br)cc2C1=O |
| InChI | InChI=1S/C16H18BrN3O5/c1-25-7-4-13(21)18-5-6-19-14(22)9-20-15(23)11-3-2-10(17)8-12(11)16(20)24/h2-3,8H,4-7,9H2,1H3,(H,18,21)(H,19,22) |
| InChIKey | BTYHYRJYQWNIMW-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.24 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|