C17H20BrN3O5 — CID 108574033
2-methylpropyl N-[2-[[2-(5-bromo-1,3-dioxoisoindol-2-yl)acetyl]amino]ethyl]carbamate (PubChem CID 108574033) has the molecular formula C17H20BrN3O5 and a molecular weight of 426.27 g/mol. Its IUPAC name is 2-methylpropyl N-[2-[[2-(5-bromo-1,3-dioxoisoindol-2-yl)acetyl]amino]ethyl]carbamate.
| Compound Name | 2-methylpropyl N-[2-[[2-(5-bromo-1,3-dioxoisoindol-2-yl)acetyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 108574033 |
| Molecular Formula | C17H20BrN3O5 |
| Molecular Weight | 426.27 g/mol |
| Exact Mass | 425.06 |
| IUPAC Name | 2-methylpropyl N-[2-[[2-(5-bromo-1,3-dioxoisoindol-2-yl)acetyl]amino]ethyl]carbamate |
| SMILES | CC(C)COC(=O)NCCNC(=O)CN1C(=O)c2ccc(Br)cc2C1=O |
| InChI | InChI=1S/C17H20BrN3O5/c1-10(2)9-26-17(25)20-6-5-19-14(22)8-21-15(23)12-4-3-11(18)7-13(12)16(21)24/h3-4,7,10H,5-6,8-9H2,1-2H3,(H,19,22)(H,20,25) |
| InChIKey | RKDZCUBCDXQRGX-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.27 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|