C12H10BrNO4 — CID 698673
ethyl 2-(5-bromo-1,3-dioxoisoindol-2-yl)acetate (PubChem CID 698673) has the molecular formula C12H10BrNO4 and a molecular weight of 312.12 g/mol. Its IUPAC name is ethyl 2-(5-bromo-1,3-dioxoisoindol-2-yl)acetate.
| Compound Name | ethyl 2-(5-bromo-1,3-dioxoisoindol-2-yl)acetate |
|---|---|
| PubChem CID | 698673 |
| Molecular Formula | C12H10BrNO4 |
| Molecular Weight | 312.12 g/mol |
| Exact Mass | 310.98 |
| IUPAC Name | ethyl 2-(5-bromo-1,3-dioxoisoindol-2-yl)acetate |
| SMILES | CCOC(=O)CN1C(=O)c2ccc(Br)cc2C1=O |
| InChI | InChI=1S/C12H10BrNO4/c1-2-18-10(15)6-14-11(16)8-4-3-7(13)5-9(8)12(14)17/h3-5H,2,6H2,1H3 |
| InChIKey | QOQGVDUMTYUNOF-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.12 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|