C17H20BrN3O3 — CID 119519112
2-[2-[4-(1-aminoethyl)piperidin-1-yl]-2-oxoethyl]-5-bromoisoindole-1,3-dione (PubChem CID 119519112) has the molecular formula C17H20BrN3O3 and a molecular weight of 394.27 g/mol. Its IUPAC name is 2-[2-[4-(1-aminoethyl)piperidin-1-yl]-2-oxoethyl]-5-bromoisoindole-1,3-dione.
| Compound Name | 2-[2-[4-(1-aminoethyl)piperidin-1-yl]-2-oxoethyl]-5-bromoisoindole-1,3-dione |
|---|---|
| PubChem CID | 119519112 |
| Molecular Formula | C17H20BrN3O3 |
| Molecular Weight | 394.27 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | 2-[2-[4-(1-aminoethyl)piperidin-1-yl]-2-oxoethyl]-5-bromoisoindole-1,3-dione |
| SMILES | CC(N)C1CCN(C(=O)CN2C(=O)c3ccc(Br)cc3C2=O)CC1 |
| InChI | InChI=1S/C17H20BrN3O3/c1-10(19)11-4-6-20(7-5-11)15(22)9-21-16(23)13-3-2-12(18)8-14(13)17(21)24/h2-3,8,10-11H,4-7,9,19H2,1H3 |
| InChIKey | IQTAMWCJRXXUPF-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.27 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|