C15H17BrClN3O3 — CID 119416654
5-bromo-2-[2-(1,4-diazepan-1-yl)-2-oxoethyl]isoindole-1,3-dione;hydrochloride (PubChem CID 119416654) has the molecular formula C15H17BrClN3O3 and a molecular weight of 402.68 g/mol. Its IUPAC name is 5-bromo-2-[2-(1,4-diazepan-1-yl)-2-oxoethyl]isoindole-1,3-dione;hydrochloride.
| Compound Name | 5-bromo-2-[2-(1,4-diazepan-1-yl)-2-oxoethyl]isoindole-1,3-dione;hydrochloride |
|---|---|
| PubChem CID | 119416654 |
| Molecular Formula | C15H17BrClN3O3 |
| Molecular Weight | 402.68 g/mol |
| Exact Mass | 401.01 |
| IUPAC Name | 5-bromo-2-[2-(1,4-diazepan-1-yl)-2-oxoethyl]isoindole-1,3-dione;hydrochloride |
| SMILES | Cl.O=C(CN1C(=O)c2ccc(Br)cc2C1=O)N1CCCNCC1 |
| InChI | InChI=1S/C15H16BrN3O3.ClH/c16-10-2-3-11-12(8-10)15(22)19(14(11)21)9-13(20)18-6-1-4-17-5-7-18;/h2-3,8,17H,1,4-7,9H2;1H |
| InChIKey | KTQRICFGXMQSGU-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.68 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|