C13H18BrClN2O — CID 119416494
2-(4-bromophenyl)-1-(1,4-diazepan-1-yl)ethanone;hydrochloride (PubChem CID 119416494) has the molecular formula C13H18BrClN2O and a molecular weight of 333.66 g/mol. Its IUPAC name is 2-(4-bromophenyl)-1-(1,4-diazepan-1-yl)ethanone;hydrochloride.
| Compound Name | 2-(4-bromophenyl)-1-(1,4-diazepan-1-yl)ethanone;hydrochloride |
|---|---|
| PubChem CID | 119416494 |
| Molecular Formula | C13H18BrClN2O |
| Molecular Weight | 333.66 g/mol |
| Exact Mass | 332.03 |
| IUPAC Name | 2-(4-bromophenyl)-1-(1,4-diazepan-1-yl)ethanone;hydrochloride |
| SMILES | Cl.O=C(Cc1ccc(Br)cc1)N1CCCNCC1 |
| InChI | InChI=1S/C13H17BrN2O.ClH/c14-12-4-2-11(3-5-12)10-13(17)16-8-1-6-15-7-9-16;/h2-5,15H,1,6-10H2;1H |
| InChIKey | YZYIEOOFTZPRSV-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.66 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |