C12H14BrNO2 — CID 110739668
2-(4-bromophenyl)-1-(1,3-oxazinan-3-yl)ethanone (PubChem CID 110739668) has the molecular formula C12H14BrNO2 and a molecular weight of 284.15 g/mol. Its IUPAC name is 2-(4-bromophenyl)-1-(1,3-oxazinan-3-yl)ethanone.
| Compound Name | 2-(4-bromophenyl)-1-(1,3-oxazinan-3-yl)ethanone |
|---|---|
| PubChem CID | 110739668 |
| Molecular Formula | C12H14BrNO2 |
| Molecular Weight | 284.15 g/mol |
| Exact Mass | 283.02 |
| IUPAC Name | 2-(4-bromophenyl)-1-(1,3-oxazinan-3-yl)ethanone |
| SMILES | O=C(Cc1ccc(Br)cc1)N1CCCOC1 |
| InChI | InChI=1S/C12H14BrNO2/c13-11-4-2-10(3-5-11)8-12(15)14-6-1-7-16-9-14/h2-5H,1,6-9H2 |
| InChIKey | DMHSDMHEWZBQRJ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.15 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |