C13H16BrNO2 — CID 110739849
2-(4-bromophenyl)-1-(2-methyl-1,3-oxazinan-3-yl)ethanone (PubChem CID 110739849) has the molecular formula C13H16BrNO2 and a molecular weight of 298.18 g/mol. Its IUPAC name is 2-(4-bromophenyl)-1-(2-methyl-1,3-oxazinan-3-yl)ethanone.
| Compound Name | 2-(4-bromophenyl)-1-(2-methyl-1,3-oxazinan-3-yl)ethanone |
|---|---|
| PubChem CID | 110739849 |
| Molecular Formula | C13H16BrNO2 |
| Molecular Weight | 298.18 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | 2-(4-bromophenyl)-1-(2-methyl-1,3-oxazinan-3-yl)ethanone |
| SMILES | CC1OCCCN1C(=O)Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C13H16BrNO2/c1-10-15(7-2-8-17-10)13(16)9-11-3-5-12(14)6-4-11/h3-6,10H,2,7-9H2,1H3 |
| InChIKey | SKVMELDBSIRKDG-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.18 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |