C15H19BrN2O2 — CID 94200570
(3R,6S)-1-[2-(4-bromophenyl)acetyl]-6-methylpiperidine-3-carboxamide (PubChem CID 94200570) has the molecular formula C15H19BrN2O2 and a molecular weight of 339.23 g/mol. Its IUPAC name is (3R,6S)-1-[2-(4-bromophenyl)acetyl]-6-methylpiperidine-3-carboxamide.
| Compound Name | (3R,6S)-1-[2-(4-bromophenyl)acetyl]-6-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 94200570 |
| Molecular Formula | C15H19BrN2O2 |
| Molecular Weight | 339.23 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | (3R,6S)-1-[2-(4-bromophenyl)acetyl]-6-methylpiperidine-3-carboxamide |
| SMILES | C[C@H]1CC[C@@H](C(N)=O)CN1C(=O)Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C15H19BrN2O2/c1-10-2-5-12(15(17)20)9-18(10)14(19)8-11-3-6-13(16)7-4-11/h3-4,6-7,10,12H,2,5,8-9H2,1H3,(H2,17,20)/t10-,12+/m0/s1 |
| InChIKey | XXLPYBZXXBPRRL-CMPLNLGQSA-N |
| XLogP | 2.10 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.23 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |