C18H26N2O3 — CID 95584899
(3S,6S)-1-[3-(4-ethoxyphenyl)propanoyl]-6-methylpiperidine-3-carboxamide (PubChem CID 95584899) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is (3S,6S)-1-[3-(4-ethoxyphenyl)propanoyl]-6-methylpiperidine-3-carboxamide.
| Compound Name | (3S,6S)-1-[3-(4-ethoxyphenyl)propanoyl]-6-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 95584899 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | (3S,6S)-1-[3-(4-ethoxyphenyl)propanoyl]-6-methylpiperidine-3-carboxamide |
| SMILES | CCOc1ccc(CCC(=O)N2C[C@@H](C(N)=O)CC[C@@H]2C)cc1 |
| InChI | InChI=1S/C18H26N2O3/c1-3-23-16-9-5-14(6-10-16)7-11-17(21)20-12-15(18(19)22)8-4-13(20)2/h5-6,9-10,13,15H,3-4,7-8,11-12H2,1-2H3,(H2,19,22)/t13-,15-/m0/s1 |
| InChIKey | ISAMURLNPHLTLG-ZFWWWQNUSA-N |
| XLogP | 2.13 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |