C13H18N2O2S — CID 94200571
(3S,6R)-6-methyl-1-(2-thiophen-3-ylacetyl)piperidine-3-carboxamide (PubChem CID 94200571) has the molecular formula C13H18N2O2S and a molecular weight of 266.37 g/mol. Its IUPAC name is (3S,6R)-6-methyl-1-(2-thiophen-3-ylacetyl)piperidine-3-carboxamide.
| Compound Name | (3S,6R)-6-methyl-1-(2-thiophen-3-ylacetyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 94200571 |
| Molecular Formula | C13H18N2O2S |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | (3S,6R)-6-methyl-1-(2-thiophen-3-ylacetyl)piperidine-3-carboxamide |
| SMILES | C[C@@H]1CC[C@H](C(N)=O)CN1C(=O)Cc1ccsc1 |
| InChI | InChI=1S/C13H18N2O2S/c1-9-2-3-11(13(14)17)7-15(9)12(16)6-10-4-5-18-8-10/h4-5,8-9,11H,2-3,6-7H2,1H3,(H2,14,17)/t9-,11+/m1/s1 |
| InChIKey | RJYMKYZCLKGFBD-KOLCDFICSA-N |
| XLogP | 1.40 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |