C18H21N3O2 — CID 95585501
(3S,6S)-6-methyl-1-(2-quinolin-8-ylacetyl)piperidine-3-carboxamide (PubChem CID 95585501) has the molecular formula C18H21N3O2 and a molecular weight of 311.38 g/mol. Its IUPAC name is (3S,6S)-6-methyl-1-(2-quinolin-8-ylacetyl)piperidine-3-carboxamide.
| Compound Name | (3S,6S)-6-methyl-1-(2-quinolin-8-ylacetyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 95585501 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | (3S,6S)-6-methyl-1-(2-quinolin-8-ylacetyl)piperidine-3-carboxamide |
| SMILES | C[C@H]1CC[C@H](C(N)=O)CN1C(=O)Cc1cccc2cccnc12 |
| InChI | InChI=1S/C18H21N3O2/c1-12-7-8-15(18(19)23)11-21(12)16(22)10-14-5-2-4-13-6-3-9-20-17(13)14/h2-6,9,12,15H,7-8,10-11H2,1H3,(H2,19,23)/t12-,15-/m0/s1 |
| InChIKey | FHAMCYWKXYROKF-WFASDCNBSA-N |
| XLogP | 1.89 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |