C13H17NO3 — CID 110746558
2-(4-ethoxyphenyl)-1-(1,3-oxazolidin-3-yl)ethanone (PubChem CID 110746558) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)-1-(1,3-oxazolidin-3-yl)ethanone.
| Compound Name | 2-(4-ethoxyphenyl)-1-(1,3-oxazolidin-3-yl)ethanone |
|---|---|
| PubChem CID | 110746558 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 2-(4-ethoxyphenyl)-1-(1,3-oxazolidin-3-yl)ethanone |
| SMILES | CCOc1ccc(CC(=O)N2CCOC2)cc1 |
| InChI | InChI=1S/C13H17NO3/c1-2-17-12-5-3-11(4-6-12)9-13(15)14-7-8-16-10-14/h3-6H,2,7-10H2,1H3 |
| InChIKey | LNLZAPUOVJMOBI-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |