C20H27N3O5 — CID 55471046
1-[4-[2-(4-ethoxyphenyl)acetyl]piperazin-1-yl]-2-morpholin-4-ylethane-1,2-dione (PubChem CID 55471046) has the molecular formula C20H27N3O5 and a molecular weight of 389.45 g/mol. Its IUPAC name is 1-[4-[2-(4-ethoxyphenyl)acetyl]piperazin-1-yl]-2-morpholin-4-ylethane-1,2-dione.
| Compound Name | 1-[4-[2-(4-ethoxyphenyl)acetyl]piperazin-1-yl]-2-morpholin-4-ylethane-1,2-dione |
|---|---|
| PubChem CID | 55471046 |
| Molecular Formula | C20H27N3O5 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | 1-[4-[2-(4-ethoxyphenyl)acetyl]piperazin-1-yl]-2-morpholin-4-ylethane-1,2-dione |
| SMILES | CCOc1ccc(CC(=O)N2CCN(C(=O)C(=O)N3CCOCC3)CC2)cc1 |
| InChI | InChI=1S/C20H27N3O5/c1-2-28-17-5-3-16(4-6-17)15-18(24)21-7-9-22(10-8-21)19(25)20(26)23-11-13-27-14-12-23/h3-6H,2,7-15H2,1H3 |
| InChIKey | GMVPYMZYLAQCMC-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|