C13H14N4O3 — CID 63303544
2-(2-oxo-2-piperazin-1-ylethyl)pyrrolo[3,4-c]pyridine-1,3-dione (PubChem CID 63303544) has the molecular formula C13H14N4O3 and a molecular weight of 274.28 g/mol. Its IUPAC name is 2-(2-oxo-2-piperazin-1-ylethyl)pyrrolo[3,4-c]pyridine-1,3-dione.
| Compound Name | 2-(2-oxo-2-piperazin-1-ylethyl)pyrrolo[3,4-c]pyridine-1,3-dione |
|---|---|
| PubChem CID | 63303544 |
| Molecular Formula | C13H14N4O3 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 2-(2-oxo-2-piperazin-1-ylethyl)pyrrolo[3,4-c]pyridine-1,3-dione |
| SMILES | O=C(CN1C(=O)c2ccncc2C1=O)N1CCNCC1 |
| InChI | InChI=1S/C13H14N4O3/c18-11(16-5-3-14-4-6-16)8-17-12(19)9-1-2-15-7-10(9)13(17)20/h1-2,7,14H,3-6,8H2 |
| InChIKey | MAOLNDOOXAKMTB-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|