C9H7ClN2O2 — CID 71670235
2-(2-chloroethyl)pyrrolo[3,4-c]pyridine-1,3-dione (PubChem CID 71670235) has the molecular formula C9H7ClN2O2 and a molecular weight of 210.62 g/mol. Its IUPAC name is 2-(2-chloroethyl)pyrrolo[3,4-c]pyridine-1,3-dione.
| Compound Name | 2-(2-chloroethyl)pyrrolo[3,4-c]pyridine-1,3-dione |
|---|---|
| PubChem CID | 71670235 |
| Molecular Formula | C9H7ClN2O2 |
| Molecular Weight | 210.62 g/mol |
| Exact Mass | 210.02 |
| IUPAC Name | 2-(2-chloroethyl)pyrrolo[3,4-c]pyridine-1,3-dione |
| SMILES | O=C1c2ccncc2C(=O)N1CCCl |
| InChI | InChI=1S/C9H7ClN2O2/c10-2-4-12-8(13)6-1-3-11-5-7(6)9(12)14/h1,3,5H,2,4H2 |
| InChIKey | RUUWBIPSKPYDNY-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.62 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|