C10H9IN2O2 — CID 66584998
2-(3-iodopropyl)pyrrolo[3,4-c]pyridine-1,3-dione (PubChem CID 66584998) has the molecular formula C10H9IN2O2 and a molecular weight of 316.10 g/mol. Its IUPAC name is 2-(3-iodopropyl)pyrrolo[3,4-c]pyridine-1,3-dione.
| Compound Name | 2-(3-iodopropyl)pyrrolo[3,4-c]pyridine-1,3-dione |
|---|---|
| PubChem CID | 66584998 |
| Molecular Formula | C10H9IN2O2 |
| Molecular Weight | 316.10 g/mol |
| Exact Mass | 315.97 |
| IUPAC Name | 2-(3-iodopropyl)pyrrolo[3,4-c]pyridine-1,3-dione |
| SMILES | O=C1c2ccncc2C(=O)N1CCCI |
| InChI | InChI=1S/C10H9IN2O2/c11-3-1-5-13-9(14)7-2-4-12-6-8(7)10(13)15/h2,4,6H,1,3,5H2 |
| InChIKey | KZSDVCILXFSDEH-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.10 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|