C14H16N4O4S — CID 166506358
2-[2-[2-(1,3-dioxopyrrolo[3,4-c]pyridin-2-yl)ethylamino]-2-oxoethyl]sulfanyl-N-methylacetamide (PubChem CID 166506358) has the molecular formula C14H16N4O4S and a molecular weight of 336.37 g/mol. Its IUPAC name is 2-[2-[2-(1,3-dioxopyrrolo[3,4-c]pyridin-2-yl)ethylamino]-2-oxoethyl]sulfanyl-N-methylacetamide.
| Compound Name | 2-[2-[2-(1,3-dioxopyrrolo[3,4-c]pyridin-2-yl)ethylamino]-2-oxoethyl]sulfanyl-N-methylacetamide |
|---|---|
| PubChem CID | 166506358 |
| Molecular Formula | C14H16N4O4S |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 2-[2-[2-(1,3-dioxopyrrolo[3,4-c]pyridin-2-yl)ethylamino]-2-oxoethyl]sulfanyl-N-methylacetamide |
| SMILES | CNC(=O)CSCC(=O)NCCN1C(=O)c2ccncc2C1=O |
| InChI | InChI=1S/C14H16N4O4S/c1-15-11(19)7-23-8-12(20)17-4-5-18-13(21)9-2-3-16-6-10(9)14(18)22/h2-3,6H,4-5,7-8H2,1H3,(H,15,19)(H,17,20) |
| InChIKey | SUXYECQLKOAUIV-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|