C15H16N2O4S — CID 153346651
N-[2-(1,3-dioxoisoindol-2-yl)ethyl]-2-(2-oxopropylsulfanyl)acetamide (PubChem CID 153346651) has the molecular formula C15H16N2O4S and a molecular weight of 320.37 g/mol. Its IUPAC name is N-[2-(1,3-dioxoisoindol-2-yl)ethyl]-2-(2-oxopropylsulfanyl)acetamide.
| Compound Name | N-[2-(1,3-dioxoisoindol-2-yl)ethyl]-2-(2-oxopropylsulfanyl)acetamide |
|---|---|
| PubChem CID | 153346651 |
| Molecular Formula | C15H16N2O4S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | N-[2-(1,3-dioxoisoindol-2-yl)ethyl]-2-(2-oxopropylsulfanyl)acetamide |
| SMILES | CC(=O)CSCC(=O)NCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C15H16N2O4S/c1-10(18)8-22-9-13(19)16-6-7-17-14(20)11-4-2-3-5-12(11)15(17)21/h2-5H,6-9H2,1H3,(H,16,19) |
| InChIKey | AKVLGATXKHSMED-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|