2-[(1,3-dioxopyrrolo[3,4-c]pyridin-2-yl)methyl]butanoic acid

C12H12N2O4 — CID 65222157

IUPAC2-[(1,3-dioxopyrrolo[3,4-c]pyridin-2-yl)methyl]butanoic acid
SMILESCCC(CN1C(=O)c2ccncc2C1=O)C(=O)O
InChIInChI=1S/C12H12N2O4/c1-2-7(12(17)18)6-14-10(15)8-3-4-13-5-9(8)11(14)16/h3-5,7H,2,6H2,1H3,(H,17,18)
InChIKeyBSWQVGSDACUBBQ-UHFFFAOYSA-N
MW248.24 g/mol
LogP0.79
Rot. Bonds4

About 2-[(1,3-dioxopyrrolo[3,4-c]pyridin-2-yl)methyl]butanoic acid

2-[(1,3-dioxopyrrolo[3,4-c]pyridin-2-yl)methyl]butanoic acid (PubChem CID 65222157) has the molecular formula C12H12N2O4 and a molecular weight of 248.24 g/mol. Its IUPAC name is 2-[(1,3-dioxopyrrolo[3,4-c]pyridin-2-yl)methyl]butanoic acid.

Molecular Properties

Compound Name2-[(1,3-dioxopyrrolo[3,4-c]pyridin-2-yl)methyl]butanoic acid
PubChem CID65222157
Molecular FormulaC12H12N2O4
Molecular Weight248.24 g/mol
Exact Mass248.08
IUPAC Name2-[(1,3-dioxopyrrolo[3,4-c]pyridin-2-yl)methyl]butanoic acid
SMILESCCC(CN1C(=O)c2ccncc2C1=O)C(=O)O
InChIInChI=1S/C12H12N2O4/c1-2-7(12(17)18)6-14-10(15)8-3-4-13-5-9(8)11(14)16/h3-5,7H,2,6H2,1H3,(H,17,18)
InChIKeyBSWQVGSDACUBBQ-UHFFFAOYSA-N
XLogP0.79
TPSA87.57 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500248.24
LogP ≤ 50.79
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phthalimide', 'substructure': 'N/A'}

Analyze 2-[(1,3-dioxopyrrolo[3,4-c]pyridin-2-yl)methyl]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(1,3-dioxopyrrolo[3,4-c]pyridin-2-yl)methyl]butanoic acid?
The IUPAC name of 2-[(1,3-dioxopyrrolo[3,4-c]pyridin-2-yl)methyl]butanoic acid (CID 65222157) is 2-[(1,3-dioxopyrrolo[3,4-c]pyridin-2-yl)methyl]butanoic acid.
What is the SMILES notation for 2-[(1,3-dioxopyrrolo[3,4-c]pyridin-2-yl)methyl]butanoic acid?
The canonical SMILES for 2-[(1,3-dioxopyrrolo[3,4-c]pyridin-2-yl)methyl]butanoic acid is CCC(CN1C(=O)c2ccncc2C1=O)C(=O)O.
What is the InChIKey of 2-[(1,3-dioxopyrrolo[3,4-c]pyridin-2-yl)methyl]butanoic acid?
The InChIKey is BSWQVGSDACUBBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O4/c1-2-7(12(17)18)6-14-10(15)8-3-4-13-5-9(8)11(14)16/h3-5,7H,2,6H2,1H3,(H,17,18).
What are the key properties of 2-[(1,3-dioxopyrrolo[3,4-c]pyridin-2-yl)methyl]butanoic acid?
2-[(1,3-dioxopyrrolo[3,4-c]pyridin-2-yl)methyl]butanoic acid has a molecular weight of 248.24 g/mol, XLogP of 0.79, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1,3-dioxopyrrolo[3,4-c]pyridin-2-yl)methyl]butanoic acid is sourced from PubChem (CID 65222157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).