C19H18N2O4S — CID 166232666
2-(1,3-dioxopyrrolo[3,4-c]pyridin-2-yl)ethyl 4-propan-2-ylsulfanylbenzoate (PubChem CID 166232666) has the molecular formula C19H18N2O4S and a molecular weight of 370.43 g/mol. Its IUPAC name is 2-(1,3-dioxopyrrolo[3,4-c]pyridin-2-yl)ethyl 4-propan-2-ylsulfanylbenzoate.
| Compound Name | 2-(1,3-dioxopyrrolo[3,4-c]pyridin-2-yl)ethyl 4-propan-2-ylsulfanylbenzoate |
|---|---|
| PubChem CID | 166232666 |
| Molecular Formula | C19H18N2O4S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | 2-(1,3-dioxopyrrolo[3,4-c]pyridin-2-yl)ethyl 4-propan-2-ylsulfanylbenzoate |
| SMILES | CC(C)Sc1ccc(C(=O)OCCN2C(=O)c3ccncc3C2=O)cc1 |
| InChI | InChI=1S/C19H18N2O4S/c1-12(2)26-14-5-3-13(4-6-14)19(24)25-10-9-21-17(22)15-7-8-20-11-16(15)18(21)23/h3-8,11-12H,9-10H2,1-2H3 |
| InChIKey | ZUDALIYBDGYWJD-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|