C17H17N3O4 — CID 16575759
4-(1,3-dioxoisoindol-2-yl)butyl 1-methylpyrazole-4-carboxylate (PubChem CID 16575759) has the molecular formula C17H17N3O4 and a molecular weight of 327.34 g/mol. Its IUPAC name is 4-(1,3-dioxoisoindol-2-yl)butyl 1-methylpyrazole-4-carboxylate.
| Compound Name | 4-(1,3-dioxoisoindol-2-yl)butyl 1-methylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 16575759 |
| Molecular Formula | C17H17N3O4 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 4-(1,3-dioxoisoindol-2-yl)butyl 1-methylpyrazole-4-carboxylate |
| SMILES | Cn1cc(C(=O)OCCCCN2C(=O)c3ccccc3C2=O)cn1 |
| InChI | InChI=1S/C17H17N3O4/c1-19-11-12(10-18-19)17(23)24-9-5-4-8-20-15(21)13-6-2-3-7-14(13)16(20)22/h2-3,6-7,10-11H,4-5,8-9H2,1H3 |
| InChIKey | VCADPUOIONZHDT-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|