C18H15ClN2O4 — CID 46790903
4-(1,3-dioxoisoindol-2-yl)butyl 2-chloropyridine-3-carboxylate (PubChem CID 46790903) has the molecular formula C18H15ClN2O4 and a molecular weight of 358.78 g/mol. Its IUPAC name is 4-(1,3-dioxoisoindol-2-yl)butyl 2-chloropyridine-3-carboxylate.
| Compound Name | 4-(1,3-dioxoisoindol-2-yl)butyl 2-chloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 46790903 |
| Molecular Formula | C18H15ClN2O4 |
| Molecular Weight | 358.78 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | 4-(1,3-dioxoisoindol-2-yl)butyl 2-chloropyridine-3-carboxylate |
| SMILES | O=C(OCCCCN1C(=O)c2ccccc2C1=O)c1cccnc1Cl |
| InChI | InChI=1S/C18H15ClN2O4/c19-15-14(8-5-9-20-15)18(24)25-11-4-3-10-21-16(22)12-6-1-2-7-13(12)17(21)23/h1-2,5-9H,3-4,10-11H2 |
| InChIKey | IWPFLGKQHQLTQJ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.78 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|