About 2-(1,3-dioxoisoindol-2-yl)ethyl 2-phenylsulfanylpyridine-3-carboxylate
2-(1,3-dioxoisoindol-2-yl)ethyl 2-phenylsulfanylpyridine-3-carboxylate (PubChem CID 16515071) has the molecular formula C22H16N2O4S
and a molecular weight of 404.45 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)ethyl 2-phenylsulfanylpyridine-3-carboxylate.
Molecular Properties
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 2-phenylsulfanylpyridine-3-carboxylate |
| PubChem CID | 16515071 |
| Molecular Formula | C22H16N2O4S |
| Molecular Weight | 404.45 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 2-phenylsulfanylpyridine-3-carboxylate |
| SMILES | O=C(OCCN1C(=O)c2ccccc2C1=O)c1cccnc1Sc1ccccc1 |
| InChI | InChI=1S/C22H16N2O4S/c25-20-16-9-4-5-10-17(16)21(26)24(20)13-14-28-22(27)18-11-6-12-23-19(18)29-15-7-2-1-3-8-15/h1-12H,13-14H2 |
| InChIKey | PHLBVBCVPRGKFB-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.45 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,3-dioxoisoindol-2-yl)ethyl 2-phenylsulfanylpyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-dioxoisoindol-2-yl)ethyl 2-phenylsulfanylpyridine-3-carboxylate?
The IUPAC name of 2-(1,3-dioxoisoindol-2-yl)ethyl 2-phenylsulfanylpyridine-3-carboxylate (CID 16515071) is 2-(1,3-dioxoisoindol-2-yl)ethyl 2-phenylsulfanylpyridine-3-carboxylate.
What is the SMILES notation for 2-(1,3-dioxoisoindol-2-yl)ethyl 2-phenylsulfanylpyridine-3-carboxylate?
The canonical SMILES for 2-(1,3-dioxoisoindol-2-yl)ethyl 2-phenylsulfanylpyridine-3-carboxylate is O=C(OCCN1C(=O)c2ccccc2C1=O)c1cccnc1Sc1ccccc1.
What is the InChIKey of 2-(1,3-dioxoisoindol-2-yl)ethyl 2-phenylsulfanylpyridine-3-carboxylate?
The InChIKey is PHLBVBCVPRGKFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16N2O4S/c25-20-16-9-4-5-10-17(16)21(26)24(20)13-14-28-22(27)18-11-6-12-23-19(18)29-15-7-2-1-3-8-15/h1-12H,13-14H2.
What are the key properties of 2-(1,3-dioxoisoindol-2-yl)ethyl 2-phenylsulfanylpyridine-3-carboxylate?
2-(1,3-dioxoisoindol-2-yl)ethyl 2-phenylsulfanylpyridine-3-carboxylate has a molecular weight of 404.45 g/mol, XLogP of 3.69, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-dioxoisoindol-2-yl)ethyl 2-phenylsulfanylpyridine-3-carboxylate is sourced from PubChem (CID 16515071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).