C22H16N2O4S — CID 16515071
2-(1,3-dioxoisoindol-2-yl)ethyl 2-phenylsulfanylpyridine-3-carboxylate (PubChem CID 16515071) has the molecular formula C22H16N2O4S and a molecular weight of 404.45 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)ethyl 2-phenylsulfanylpyridine-3-carboxylate.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 2-phenylsulfanylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 16515071 |
| Molecular Formula | C22H16N2O4S |
| Molecular Weight | 404.45 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 2-phenylsulfanylpyridine-3-carboxylate |
| SMILES | O=C(OCCN1C(=O)c2ccccc2C1=O)c1cccnc1Sc1ccccc1 |
| InChI | InChI=1S/C22H16N2O4S/c25-20-16-9-4-5-10-17(16)21(26)24(20)13-14-28-22(27)18-11-6-12-23-19(18)29-15-7-2-1-3-8-15/h1-12H,13-14H2 |
| InChIKey | PHLBVBCVPRGKFB-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.45 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|