C25H21NO6 — CID 4537323
2-(1,3-dioxoisoindol-2-yl)ethyl 2-(2-phenoxyethoxy)benzoate (PubChem CID 4537323) has the molecular formula C25H21NO6 and a molecular weight of 431.44 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)ethyl 2-(2-phenoxyethoxy)benzoate.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 2-(2-phenoxyethoxy)benzoate |
|---|---|
| PubChem CID | 4537323 |
| Molecular Formula | C25H21NO6 |
| Molecular Weight | 431.44 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 2-(2-phenoxyethoxy)benzoate |
| SMILES | O=C(OCCN1C(=O)c2ccccc2C1=O)c1ccccc1OCCOc1ccccc1 |
| InChI | InChI=1S/C25H21NO6/c27-23-19-10-4-5-11-20(19)24(28)26(23)14-15-32-25(29)21-12-6-7-13-22(21)31-17-16-30-18-8-2-1-3-9-18/h1-13H,14-17H2 |
| InChIKey | WQIQQVCANMPYEH-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.44 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|