C24H19NO5 — CID 8920001
2-(1,3-dioxoisoindol-2-yl)ethyl 2-(2-phenylphenoxy)acetate (PubChem CID 8920001) has the molecular formula C24H19NO5 and a molecular weight of 401.42 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)ethyl 2-(2-phenylphenoxy)acetate.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 2-(2-phenylphenoxy)acetate |
|---|---|
| PubChem CID | 8920001 |
| Molecular Formula | C24H19NO5 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 2-(2-phenylphenoxy)acetate |
| SMILES | O=C(COc1ccccc1-c1ccccc1)OCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C24H19NO5/c26-22(16-30-21-13-7-6-10-18(21)17-8-2-1-3-9-17)29-15-14-25-23(27)19-11-4-5-12-20(19)24(25)28/h1-13H,14-16H2 |
| InChIKey | KSDYCLNXYFVILX-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|