C21H19NO6 — CID 9326697
2-(1,3-dioxoisoindol-2-yl)ethyl 2-(4-propanoylphenoxy)acetate (PubChem CID 9326697) has the molecular formula C21H19NO6 and a molecular weight of 381.38 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)ethyl 2-(4-propanoylphenoxy)acetate.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 2-(4-propanoylphenoxy)acetate |
|---|---|
| PubChem CID | 9326697 |
| Molecular Formula | C21H19NO6 |
| Molecular Weight | 381.38 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 2-(4-propanoylphenoxy)acetate |
| SMILES | CCC(=O)c1ccc(OCC(=O)OCCN2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C21H19NO6/c1-2-18(23)14-7-9-15(10-8-14)28-13-19(24)27-12-11-22-20(25)16-5-3-4-6-17(16)21(22)26/h3-10H,2,11-13H2,1H3 |
| InChIKey | MVPPVYVVEJLRRQ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.38 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|