C20H19NO6 — CID 14536972
ethyl 2-[4-[2-(1,3-dioxoisoindol-2-yl)-1-hydroxyethyl]phenoxy]acetate (PubChem CID 14536972) has the molecular formula C20H19NO6 and a molecular weight of 369.37 g/mol. Its IUPAC name is ethyl 2-[4-[2-(1,3-dioxoisoindol-2-yl)-1-hydroxyethyl]phenoxy]acetate.
| Compound Name | ethyl 2-[4-[2-(1,3-dioxoisoindol-2-yl)-1-hydroxyethyl]phenoxy]acetate |
|---|---|
| PubChem CID | 14536972 |
| Molecular Formula | C20H19NO6 |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | ethyl 2-[4-[2-(1,3-dioxoisoindol-2-yl)-1-hydroxyethyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(C(O)CN2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C20H19NO6/c1-2-26-18(23)12-27-14-9-7-13(8-10-14)17(22)11-21-19(24)15-5-3-4-6-16(15)20(21)25/h3-10,17,22H,2,11-12H2,1H3 |
| InChIKey | UPXMFBDHNOGTBK-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|