C24H19NO6 — CID 2555543
(1,3-dioxoisoindol-2-yl)methyl 2-(4-phenylmethoxyphenoxy)acetate (PubChem CID 2555543) has the molecular formula C24H19NO6 and a molecular weight of 417.42 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl)methyl 2-(4-phenylmethoxyphenoxy)acetate.
| Compound Name | (1,3-dioxoisoindol-2-yl)methyl 2-(4-phenylmethoxyphenoxy)acetate |
|---|---|
| PubChem CID | 2555543 |
| Molecular Formula | C24H19NO6 |
| Molecular Weight | 417.42 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl)methyl 2-(4-phenylmethoxyphenoxy)acetate |
| SMILES | O=C(COc1ccc(OCc2ccccc2)cc1)OCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C24H19NO6/c26-22(31-16-25-23(27)20-8-4-5-9-21(20)24(25)28)15-30-19-12-10-18(11-13-19)29-14-17-6-2-1-3-7-17/h1-13H,14-16H2 |
| InChIKey | RJCPLSCZCBYQMN-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.42 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|