C23H17NO4 — CID 129076171
2-[2-oxo-2-(2-phenylmethoxyphenyl)ethyl]isoindole-1,3-dione (PubChem CID 129076171) has the molecular formula C23H17NO4 and a molecular weight of 371.39 g/mol. Its IUPAC name is 2-[2-oxo-2-(2-phenylmethoxyphenyl)ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-oxo-2-(2-phenylmethoxyphenyl)ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 129076171 |
| Molecular Formula | C23H17NO4 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 2-[2-oxo-2-(2-phenylmethoxyphenyl)ethyl]isoindole-1,3-dione |
| SMILES | O=C(CN1C(=O)c2ccccc2C1=O)c1ccccc1OCc1ccccc1 |
| InChI | InChI=1S/C23H17NO4/c25-20(14-24-22(26)17-10-4-5-11-18(17)23(24)27)19-12-6-7-13-21(19)28-15-16-8-2-1-3-9-16/h1-13H,14-15H2 |
| InChIKey | FAMBAQPYTABKKX-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|