C34H34N2O4 — CID 10744876
N-(1-adamantylmethyl)-2-(1,3-dioxoisoindol-2-yl)-N-(2-phenylmethoxyphenyl)acetamide (PubChem CID 10744876) has the molecular formula C34H34N2O4 and a molecular weight of 534.66 g/mol. Its IUPAC name is N-(1-adamantylmethyl)-2-(1,3-dioxoisoindol-2-yl)-N-(2-phenylmethoxyphenyl)acetamide.
| Compound Name | N-(1-adamantylmethyl)-2-(1,3-dioxoisoindol-2-yl)-N-(2-phenylmethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 10744876 |
| Molecular Formula | C34H34N2O4 |
| Molecular Weight | 534.66 g/mol |
| Exact Mass | 534.25 |
| IUPAC Name | N-(1-adamantylmethyl)-2-(1,3-dioxoisoindol-2-yl)-N-(2-phenylmethoxyphenyl)acetamide |
| SMILES | O=C1c2ccccc2C(=O)N1CC(=O)N(CC12CC3CC(CC(C3)C1)C2)c1ccccc1OCc1ccccc1 |
| InChI | InChI=1S/C34H34N2O4/c37-31(20-35-32(38)27-10-4-5-11-28(27)33(35)39)36(22-34-17-24-14-25(18-34)16-26(15-24)19-34)29-12-6-7-13-30(29)40-21-23-8-2-1-3-9-23/h1-13,24-26H,14-22H2 |
| InChIKey | AVWIPGUUWGRHCA-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.66 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|