C34H24N2O2 — CID 101487258
2,3-diisocyano-1,4-bis(2-phenylmethoxyphenyl)benzene (PubChem CID 101487258) has the molecular formula C34H24N2O2 and a molecular weight of 492.58 g/mol. Its IUPAC name is 2,3-diisocyano-1,4-bis(2-phenylmethoxyphenyl)benzene.
| Compound Name | 2,3-diisocyano-1,4-bis(2-phenylmethoxyphenyl)benzene |
|---|---|
| PubChem CID | 101487258 |
| Molecular Formula | C34H24N2O2 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | 2,3-diisocyano-1,4-bis(2-phenylmethoxyphenyl)benzene |
| SMILES | [C-]#[N+]c1c(-c2ccccc2OCc2ccccc2)ccc(-c2ccccc2OCc2ccccc2)c1[N+]#[C-] |
| InChI | InChI=1S/C34H24N2O2/c1-35-33-29(27-17-9-11-19-31(27)37-23-25-13-5-3-6-14-25)21-22-30(34(33)36-2)28-18-10-12-20-32(28)38-24-26-15-7-4-8-16-26/h3-22H,23-24H2 |
| InChIKey | VKRUCUKIWLBPAK-UHFFFAOYSA-N |
| XLogP | 9.28 |
| TPSA | 27.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|