C21H18F3NO2 — CID 171854760
3-(2-phenylmethoxyphenyl)-2-(2,2,2-trifluoroethoxy)aniline (PubChem CID 171854760) has the molecular formula C21H18F3NO2 and a molecular weight of 373.37 g/mol. Its IUPAC name is 3-(2-phenylmethoxyphenyl)-2-(2,2,2-trifluoroethoxy)aniline.
| Compound Name | 3-(2-phenylmethoxyphenyl)-2-(2,2,2-trifluoroethoxy)aniline |
|---|---|
| PubChem CID | 171854760 |
| Molecular Formula | C21H18F3NO2 |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | 3-(2-phenylmethoxyphenyl)-2-(2,2,2-trifluoroethoxy)aniline |
| SMILES | Nc1cccc(-c2ccccc2OCc2ccccc2)c1OCC(F)(F)F |
| InChI | InChI=1S/C21H18F3NO2/c22-21(23,24)14-27-20-17(10-6-11-18(20)25)16-9-4-5-12-19(16)26-13-15-7-2-1-3-8-15/h1-12H,13-14,25H2 |
| InChIKey | PYXPMRBUUXOZOM-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|