C13H15ClN2O — CID 172882825
3-phenylmethoxybenzene-1,2-diamine;hydrochloride (PubChem CID 172882825) has the molecular formula C13H15ClN2O and a molecular weight of 250.73 g/mol. Its IUPAC name is 3-phenylmethoxybenzene-1,2-diamine;hydrochloride.
| Compound Name | 3-phenylmethoxybenzene-1,2-diamine;hydrochloride |
|---|---|
| PubChem CID | 172882825 |
| Molecular Formula | C13H15ClN2O |
| Molecular Weight | 250.73 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 3-phenylmethoxybenzene-1,2-diamine;hydrochloride |
| SMILES | Cl.Nc1cccc(OCc2ccccc2)c1N |
| InChI | InChI=1S/C13H14N2O.ClH/c14-11-7-4-8-12(13(11)15)16-9-10-5-2-1-3-6-10;/h1-8H,9,14-15H2;1H |
| InChIKey | TUVHNNDXWPKTET-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.73 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|