C12H16Cl2N4O — CID 131854935
4-phenylmethoxypyridine-2,3,6-triamine;dihydrochloride (PubChem CID 131854935) has the molecular formula C12H16Cl2N4O and a molecular weight of 303.19 g/mol. Its IUPAC name is 4-phenylmethoxypyridine-2,3,6-triamine;dihydrochloride.
| Compound Name | 4-phenylmethoxypyridine-2,3,6-triamine;dihydrochloride |
|---|---|
| PubChem CID | 131854935 |
| Molecular Formula | C12H16Cl2N4O |
| Molecular Weight | 303.19 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 4-phenylmethoxypyridine-2,3,6-triamine;dihydrochloride |
| SMILES | Cl.Cl.Nc1cc(OCc2ccccc2)c(N)c(N)n1 |
| InChI | InChI=1S/C12H14N4O.2ClH/c13-10-6-9(11(14)12(15)16-10)17-7-8-4-2-1-3-5-8;;/h1-6H,7,14H2,(H4,13,15,16);2*1H |
| InChIKey | LWMQMRUDKUYVMM-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 100.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.19 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |