C21H18FN3O — CID 69177648
6-(4-fluorophenyl)-4-phenylmethoxy-5H-1,6-naphthyridin-2-amine (PubChem CID 69177648) has the molecular formula C21H18FN3O and a molecular weight of 347.39 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-4-phenylmethoxy-5H-1,6-naphthyridin-2-amine.
| Compound Name | 6-(4-fluorophenyl)-4-phenylmethoxy-5H-1,6-naphthyridin-2-amine |
|---|---|
| PubChem CID | 69177648 |
| Molecular Formula | C21H18FN3O |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 6-(4-fluorophenyl)-4-phenylmethoxy-5H-1,6-naphthyridin-2-amine |
| SMILES | Nc1cc(OCc2ccccc2)c2c(n1)C=CN(c1ccc(F)cc1)C2 |
| InChI | InChI=1S/C21H18FN3O/c22-16-6-8-17(9-7-16)25-11-10-19-18(13-25)20(12-21(23)24-19)26-14-15-4-2-1-3-5-15/h1-12H,13-14H2,(H2,23,24) |
| InChIKey | WIPAUUXDPSCBLG-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |