C26H21FN2O2 — CID 86677028
6-[1-(4-fluorophenyl)ethenyl]-3,4-bis(phenylmethoxy)pyridazine (PubChem CID 86677028) has the molecular formula C26H21FN2O2 and a molecular weight of 412.46 g/mol. Its IUPAC name is 6-[1-(4-fluorophenyl)ethenyl]-3,4-bis(phenylmethoxy)pyridazine.
| Compound Name | 6-[1-(4-fluorophenyl)ethenyl]-3,4-bis(phenylmethoxy)pyridazine |
|---|---|
| PubChem CID | 86677028 |
| Molecular Formula | C26H21FN2O2 |
| Molecular Weight | 412.46 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | 6-[1-(4-fluorophenyl)ethenyl]-3,4-bis(phenylmethoxy)pyridazine |
| SMILES | C=C(c1ccc(F)cc1)c1cc(OCc2ccccc2)c(OCc2ccccc2)nn1 |
| InChI | InChI=1S/C26H21FN2O2/c1-19(22-12-14-23(27)15-13-22)24-16-25(30-17-20-8-4-2-5-9-20)26(29-28-24)31-18-21-10-6-3-7-11-21/h2-16H,1,17-18H2 |
| InChIKey | DYTCHMHKWSXDBI-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.46 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |