C24H19FN2O2 — CID 71275863
6-(3-fluorophenyl)-3,4-bis(phenylmethoxy)pyridazine (PubChem CID 71275863) has the molecular formula C24H19FN2O2 and a molecular weight of 386.43 g/mol. Its IUPAC name is 6-(3-fluorophenyl)-3,4-bis(phenylmethoxy)pyridazine.
| Compound Name | 6-(3-fluorophenyl)-3,4-bis(phenylmethoxy)pyridazine |
|---|---|
| PubChem CID | 71275863 |
| Molecular Formula | C24H19FN2O2 |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 6-(3-fluorophenyl)-3,4-bis(phenylmethoxy)pyridazine |
| SMILES | Fc1cccc(-c2cc(OCc3ccccc3)c(OCc3ccccc3)nn2)c1 |
| InChI | InChI=1S/C24H19FN2O2/c25-21-13-7-12-20(14-21)22-15-23(28-16-18-8-3-1-4-9-18)24(27-26-22)29-17-19-10-5-2-6-11-19/h1-15H,16-17H2 |
| InChIKey | MTABTVYJYHZOOF-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |