C26H18F2N2O2 — CID 71270040
6-[2-(2,4-difluorophenyl)ethynyl]-3,4-bis(phenylmethoxy)pyridazine (PubChem CID 71270040) has the molecular formula C26H18F2N2O2 and a molecular weight of 428.44 g/mol. Its IUPAC name is 6-[2-(2,4-difluorophenyl)ethynyl]-3,4-bis(phenylmethoxy)pyridazine.
| Compound Name | 6-[2-(2,4-difluorophenyl)ethynyl]-3,4-bis(phenylmethoxy)pyridazine |
|---|---|
| PubChem CID | 71270040 |
| Molecular Formula | C26H18F2N2O2 |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | 6-[2-(2,4-difluorophenyl)ethynyl]-3,4-bis(phenylmethoxy)pyridazine |
| SMILES | Fc1ccc(C#Cc2cc(OCc3ccccc3)c(OCc3ccccc3)nn2)c(F)c1 |
| InChI | InChI=1S/C26H18F2N2O2/c27-22-13-11-21(24(28)15-22)12-14-23-16-25(31-17-19-7-3-1-4-8-19)26(30-29-23)32-18-20-9-5-2-6-10-20/h1-11,13,15-16H,17-18H2 |
| InChIKey | VASYABZLDRULNM-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|