C27H20F2N2O2 — CID 71270039
6-[2-[3-(difluoromethyl)phenyl]ethynyl]-3,4-bis(phenylmethoxy)pyridazine (PubChem CID 71270039) has the molecular formula C27H20F2N2O2 and a molecular weight of 442.47 g/mol. Its IUPAC name is 6-[2-[3-(difluoromethyl)phenyl]ethynyl]-3,4-bis(phenylmethoxy)pyridazine.
| Compound Name | 6-[2-[3-(difluoromethyl)phenyl]ethynyl]-3,4-bis(phenylmethoxy)pyridazine |
|---|---|
| PubChem CID | 71270039 |
| Molecular Formula | C27H20F2N2O2 |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | 6-[2-[3-(difluoromethyl)phenyl]ethynyl]-3,4-bis(phenylmethoxy)pyridazine |
| SMILES | FC(F)c1cccc(C#Cc2cc(OCc3ccccc3)c(OCc3ccccc3)nn2)c1 |
| InChI | InChI=1S/C27H20F2N2O2/c28-26(29)23-13-7-12-20(16-23)14-15-24-17-25(32-18-21-8-3-1-4-9-21)27(31-30-24)33-19-22-10-5-2-6-11-22/h1-13,16-17,26H,18-19H2 |
| InChIKey | QZMHEYLZCMKBAH-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|