C27H20ClF3N2O2 — CID 123198727
6-[2-[2-chloro-4-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]ethynyl]-3,4-bis(phenylmethoxy)pyridazine (PubChem CID 123198727) has the molecular formula C27H20ClF3N2O2 and a molecular weight of 496.92 g/mol. Its IUPAC name is 6-[2-[2-chloro-4-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]ethynyl]-3,4-bis(phenylmethoxy)pyridazine.
| Compound Name | 6-[2-[2-chloro-4-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]ethynyl]-3,4-bis(phenylmethoxy)pyridazine |
|---|---|
| PubChem CID | 123198727 |
| Molecular Formula | C27H20ClF3N2O2 |
| Molecular Weight | 496.92 g/mol |
| Exact Mass | 496.12 |
| IUPAC Name | 6-[2-[2-chloro-4-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]ethynyl]-3,4-bis(phenylmethoxy)pyridazine |
| SMILES | FC(F)(F)C1C=CC(C#Cc2cc(OCc3ccccc3)c(OCc3ccccc3)nn2)=C(Cl)C1 |
| InChI | InChI=1S/C27H20ClF3N2O2/c28-24-15-22(27(29,30)31)13-11-21(24)12-14-23-16-25(34-17-19-7-3-1-4-8-19)26(33-32-23)35-18-20-9-5-2-6-10-20/h1-11,13,16,22H,15,17-18H2 |
| InChIKey | WDMLFFLHFRKWFE-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.92 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|