C27H18ClF3N2O2 — CID 71270162
6-[2-[3-chloro-4-(trifluoromethyl)phenyl]ethynyl]-3,4-bis(phenylmethoxy)pyridazine (PubChem CID 71270162) has the molecular formula C27H18ClF3N2O2 and a molecular weight of 494.90 g/mol. Its IUPAC name is 6-[2-[3-chloro-4-(trifluoromethyl)phenyl]ethynyl]-3,4-bis(phenylmethoxy)pyridazine.
| Compound Name | 6-[2-[3-chloro-4-(trifluoromethyl)phenyl]ethynyl]-3,4-bis(phenylmethoxy)pyridazine |
|---|---|
| PubChem CID | 71270162 |
| Molecular Formula | C27H18ClF3N2O2 |
| Molecular Weight | 494.90 g/mol |
| Exact Mass | 494.10 |
| IUPAC Name | 6-[2-[3-chloro-4-(trifluoromethyl)phenyl]ethynyl]-3,4-bis(phenylmethoxy)pyridazine |
| SMILES | FC(F)(F)c1ccc(C#Cc2cc(OCc3ccccc3)c(OCc3ccccc3)nn2)cc1Cl |
| InChI | InChI=1S/C27H18ClF3N2O2/c28-24-15-19(12-14-23(24)27(29,30)31)11-13-22-16-25(34-17-20-7-3-1-4-8-20)26(33-32-22)35-18-21-9-5-2-6-10-21/h1-10,12,14-16H,17-18H2 |
| InChIKey | LEJTVHFPHRJBBM-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.90 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|