C23H22N2O2S — CID 118518142
3,4-bis(phenylmethoxy)-6-(2-propan-2-ylsulfanylethynyl)pyridazine (PubChem CID 118518142) has the molecular formula C23H22N2O2S and a molecular weight of 390.51 g/mol. Its IUPAC name is 3,4-bis(phenylmethoxy)-6-(2-propan-2-ylsulfanylethynyl)pyridazine.
| Compound Name | 3,4-bis(phenylmethoxy)-6-(2-propan-2-ylsulfanylethynyl)pyridazine |
|---|---|
| PubChem CID | 118518142 |
| Molecular Formula | C23H22N2O2S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | 3,4-bis(phenylmethoxy)-6-(2-propan-2-ylsulfanylethynyl)pyridazine |
| SMILES | CC(C)SC#Cc1cc(OCc2ccccc2)c(OCc2ccccc2)nn1 |
| InChI | InChI=1S/C23H22N2O2S/c1-18(2)28-14-13-21-15-22(26-16-19-9-5-3-6-10-19)23(25-24-21)27-17-20-11-7-4-8-12-20/h3-12,15,18H,16-17H2,1-2H3 |
| InChIKey | FRXUNJCIMPSNSG-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|