C27H19F3N2O3 — CID 71270488
3,4-bis(phenylmethoxy)-6-[2-[4-(trifluoromethoxy)phenyl]ethynyl]pyridazine (PubChem CID 71270488) has the molecular formula C27H19F3N2O3 and a molecular weight of 476.45 g/mol. Its IUPAC name is 3,4-bis(phenylmethoxy)-6-[2-[4-(trifluoromethoxy)phenyl]ethynyl]pyridazine.
| Compound Name | 3,4-bis(phenylmethoxy)-6-[2-[4-(trifluoromethoxy)phenyl]ethynyl]pyridazine |
|---|---|
| PubChem CID | 71270488 |
| Molecular Formula | C27H19F3N2O3 |
| Molecular Weight | 476.45 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | 3,4-bis(phenylmethoxy)-6-[2-[4-(trifluoromethoxy)phenyl]ethynyl]pyridazine |
| SMILES | FC(F)(F)Oc1ccc(C#Cc2cc(OCc3ccccc3)c(OCc3ccccc3)nn2)cc1 |
| InChI | InChI=1S/C27H19F3N2O3/c28-27(29,30)35-24-15-12-20(13-16-24)11-14-23-17-25(33-18-21-7-3-1-4-8-21)26(32-31-23)34-19-22-9-5-2-6-10-22/h1-10,12-13,15-17H,18-19H2 |
| InChIKey | AHFDLHSPLZLDOT-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.45 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|