C27H19F3N2O2 — CID 71270335
3,4-bis(phenylmethoxy)-6-[2-[3-(trifluoromethyl)phenyl]ethynyl]pyridazine (PubChem CID 71270335) has the molecular formula C27H19F3N2O2 and a molecular weight of 460.46 g/mol. Its IUPAC name is 3,4-bis(phenylmethoxy)-6-[2-[3-(trifluoromethyl)phenyl]ethynyl]pyridazine.
| Compound Name | 3,4-bis(phenylmethoxy)-6-[2-[3-(trifluoromethyl)phenyl]ethynyl]pyridazine |
|---|---|
| PubChem CID | 71270335 |
| Molecular Formula | C27H19F3N2O2 |
| Molecular Weight | 460.46 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | 3,4-bis(phenylmethoxy)-6-[2-[3-(trifluoromethyl)phenyl]ethynyl]pyridazine |
| SMILES | FC(F)(F)c1cccc(C#Cc2cc(OCc3ccccc3)c(OCc3ccccc3)nn2)c1 |
| InChI | InChI=1S/C27H19F3N2O2/c28-27(29,30)23-13-7-12-20(16-23)14-15-24-17-25(33-18-21-8-3-1-4-9-21)26(32-31-24)34-19-22-10-5-2-6-11-22/h1-13,16-17H,18-19H2 |
| InChIKey | VZDJJNGZVWDUGN-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.46 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|