C17H9F3 — CID 102444082
1-(4-phenylbuta-1,3-diynyl)-3-(trifluoromethyl)benzene (PubChem CID 102444082) has the molecular formula C17H9F3 and a molecular weight of 270.25 g/mol. Its IUPAC name is 1-(4-phenylbuta-1,3-diynyl)-3-(trifluoromethyl)benzene.
| Compound Name | 1-(4-phenylbuta-1,3-diynyl)-3-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 102444082 |
| Molecular Formula | C17H9F3 |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 1-(4-phenylbuta-1,3-diynyl)-3-(trifluoromethyl)benzene |
| SMILES | FC(F)(F)c1cccc(C#CC#Cc2ccccc2)c1 |
| InChI | InChI=1S/C17H9F3/c18-17(19,20)16-12-6-11-15(13-16)10-5-4-9-14-7-2-1-3-8-14/h1-3,6-8,11-13H |
| InChIKey | GRLGYGQJSIQQNA-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|