C12H9F3 — CID 166522965
1-pent-4-en-1-ynyl-3-(trifluoromethyl)benzene (PubChem CID 166522965) has the molecular formula C12H9F3 and a molecular weight of 210.20 g/mol. Its IUPAC name is 1-pent-4-en-1-ynyl-3-(trifluoromethyl)benzene.
| Compound Name | 1-pent-4-en-1-ynyl-3-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 166522965 |
| Molecular Formula | C12H9F3 |
| Molecular Weight | 210.20 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | 1-pent-4-en-1-ynyl-3-(trifluoromethyl)benzene |
| SMILES | C=CCC#Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H9F3/c1-2-3-4-6-10-7-5-8-11(9-10)12(13,14)15/h2,5,7-9H,1,3H2 |
| InChIKey | QOQPIUZHUYBLPL-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.20 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|