C16H11F4NO2S — CID 33331877
4-fluoro-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]benzenesulfonamide (PubChem CID 33331877) has the molecular formula C16H11F4NO2S and a molecular weight of 357.33 g/mol. Its IUPAC name is 4-fluoro-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]benzenesulfonamide.
| Compound Name | 4-fluoro-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]benzenesulfonamide |
|---|---|
| PubChem CID | 33331877 |
| Molecular Formula | C16H11F4NO2S |
| Molecular Weight | 357.33 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | 4-fluoro-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCC#Cc1cccc(C(F)(F)F)c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H11F4NO2S/c17-14-6-8-15(9-7-14)24(22,23)21-10-2-4-12-3-1-5-13(11-12)16(18,19)20/h1,3,5-9,11,21H,10H2 |
| InChIKey | WLLKZQNIBWRCJY-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.33 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|